C17H30O7 — CID 14540683
6-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]hexane-1,4-diol (PubChem CID 14540683) has the molecular formula C17H30O7 and a molecular weight of 346.42 g/mol. Its IUPAC name is 6-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]hexane-1,4-diol.
| Compound Name | 6-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]hexane-1,4-diol |
|---|---|
| PubChem CID | 14540683 |
| Molecular Formula | C17H30O7 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 6-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]hexane-1,4-diol |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](CCC(O)CCCO)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C17H30O7/c1-16(2)21-12-11(8-7-10(19)6-5-9-18)20-15-14(13(12)22-16)23-17(3,4)24-15/h10-15,18-19H,5-9H2,1-4H3/t10?,11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | XEJHFYSVEUXMQZ-SJTNETKUSA-N |
| XLogP | 1.30 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |