C18H23N3 — CID 145409460
ethane;6-ethyl-8-methyl-3-(1-methylpyrazol-4-yl)isoquinoline (PubChem CID 145409460) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is ethane;6-ethyl-8-methyl-3-(1-methylpyrazol-4-yl)isoquinoline.
| Compound Name | ethane;6-ethyl-8-methyl-3-(1-methylpyrazol-4-yl)isoquinoline |
|---|---|
| PubChem CID | 145409460 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | ethane;6-ethyl-8-methyl-3-(1-methylpyrazol-4-yl)isoquinoline |
| SMILES | CC.CCc1cc(C)c2cnc(-c3cnn(C)c3)cc2c1 |
| InChI | InChI=1S/C16H17N3.C2H6/c1-4-12-5-11(2)15-9-17-16(7-13(15)6-12)14-8-18-19(3)10-14;1-2/h5-10H,4H2,1-3H3;1-2H3 |
| InChIKey | LIDXTYFYAIDUAX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |