C15H19N3 — CID 167709418
1-(4-ethyl-2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)methanimine (PubChem CID 167709418) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 1-(4-ethyl-2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)methanimine.
| Compound Name | 1-(4-ethyl-2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)methanimine |
|---|---|
| PubChem CID | 167709418 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1-(4-ethyl-2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)methanimine |
| SMILES | CCc1cc(C)c(/C=N/c2cnn(C)c2)c(C)c1 |
| InChI | InChI=1S/C15H19N3/c1-5-13-6-11(2)15(12(3)7-13)9-16-14-8-17-18(4)10-14/h6-10H,5H2,1-4H3/b16-9+ |
| InChIKey | ZPAYRYHBDLMGAU-CXUHLZMHSA-N |
| XLogP | 3.35 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|