C25H36N2O2 — CID 145409850
acetylene;3-methoxy-13-methyl-2-piperazin-1-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 145409850) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is acetylene;3-methoxy-13-methyl-2-piperazin-1-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | acetylene;3-methoxy-13-methyl-2-piperazin-1-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 145409850 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | acetylene;3-methoxy-13-methyl-2-piperazin-1-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C#C.COc1cc2c(cc1N1CCNCC1)C1CCC3(C)C(O)CCC3C1CC2 |
| InChI | InChI=1S/C23H34N2O2.C2H2/c1-23-8-7-16-17(19(23)5-6-22(23)26)4-3-15-13-21(27-2)20(14-18(15)16)25-11-9-24-10-12-25;1-2/h13-14,16-17,19,22,24,26H,3-12H2,1-2H3;1-2H |
| InChIKey | YQKFXEAEWWZOCJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|