C26H37NO2 — CID 145411381
3-methoxy-4-[4-(4-pentylphenyl)phenyl]butan-1-amine;2-methylprop-2-enal (PubChem CID 145411381) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is 3-methoxy-4-[4-(4-pentylphenyl)phenyl]butan-1-amine;2-methylprop-2-enal.
| Compound Name | 3-methoxy-4-[4-(4-pentylphenyl)phenyl]butan-1-amine;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145411381 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | 3-methoxy-4-[4-(4-pentylphenyl)phenyl]butan-1-amine;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.CCCCCc1ccc(-c2ccc(CC(CCN)OC)cc2)cc1 |
| InChI | InChI=1S/C22H31NO.C4H6O/c1-3-4-5-6-18-7-11-20(12-8-18)21-13-9-19(10-14-21)17-22(24-2)15-16-23;1-4(2)3-5/h7-14,22H,3-6,15-17,23H2,1-2H3;3H,1H2,2H3 |
| InChIKey | YBHXVZBHIXZJJZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|