C21H18N6OS — CID 145412302
3-benzyl-2-[(2,5-dimethyl-1,3-benzothiazol-6-yl)amino]-7H-purin-6-one (PubChem CID 145412302) has the molecular formula C21H18N6OS and a molecular weight of 402.48 g/mol. Its IUPAC name is 3-benzyl-2-[(2,5-dimethyl-1,3-benzothiazol-6-yl)amino]-7H-purin-6-one.
| Compound Name | 3-benzyl-2-[(2,5-dimethyl-1,3-benzothiazol-6-yl)amino]-7H-purin-6-one |
|---|---|
| PubChem CID | 145412302 |
| Molecular Formula | C21H18N6OS |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 3-benzyl-2-[(2,5-dimethyl-1,3-benzothiazol-6-yl)amino]-7H-purin-6-one |
| SMILES | Cc1nc2cc(C)c(Nc3nc(=O)c4[nH]cnc4n3Cc3ccccc3)cc2s1 |
| InChI | InChI=1S/C21H18N6OS/c1-12-8-16-17(29-13(2)24-16)9-15(12)25-21-26-20(28)18-19(23-11-22-18)27(21)10-14-6-4-3-5-7-14/h3-9,11H,10H2,1-2H3,(H,22,23)(H,25,26,28) |
| InChIKey | PACIUZOXDHHXCO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |