C21H17ClF3N5O — CID 145412304
3-benzyl-2-(3-chloro-2-methylanilino)-7-(2,2,2-trifluoroethyl)purin-6-one (PubChem CID 145412304) has the molecular formula C21H17ClF3N5O and a molecular weight of 447.85 g/mol. Its IUPAC name is 3-benzyl-2-(3-chloro-2-methylanilino)-7-(2,2,2-trifluoroethyl)purin-6-one.
| Compound Name | 3-benzyl-2-(3-chloro-2-methylanilino)-7-(2,2,2-trifluoroethyl)purin-6-one |
|---|---|
| PubChem CID | 145412304 |
| Molecular Formula | C21H17ClF3N5O |
| Molecular Weight | 447.85 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 3-benzyl-2-(3-chloro-2-methylanilino)-7-(2,2,2-trifluoroethyl)purin-6-one |
| SMILES | Cc1c(Cl)cccc1Nc1nc(=O)c2c(ncn2CC(F)(F)F)n1Cc1ccccc1 |
| InChI | InChI=1S/C21H17ClF3N5O/c1-13-15(22)8-5-9-16(13)27-20-28-19(31)17-18(26-12-29(17)11-21(23,24)25)30(20)10-14-6-3-2-4-7-14/h2-9,12H,10-11H2,1H3,(H,27,28,31) |
| InChIKey | BVPBGZFRCIJLSS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.85 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |