C14H21N5 — CID 145413340
N-(diaminomethylidene)-2,5-dimethyl-3-phenylpyrrolidine-1-carboximidamide (PubChem CID 145413340) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,5-dimethyl-3-phenylpyrrolidine-1-carboximidamide.
| Compound Name | N-(diaminomethylidene)-2,5-dimethyl-3-phenylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 145413340 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | N-(diaminomethylidene)-2,5-dimethyl-3-phenylpyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1C(C)CC(c2ccccc2)C1C |
| InChI | InChI=1S/C14H21N5/c1-9-8-12(11-6-4-3-5-7-11)10(2)19(9)14(17)18-13(15)16/h3-7,9-10,12H,8H2,1-2H3,(H5,15,16,17,18) |
| InChIKey | YYIKXRJUBUHJLS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|