C11H15N7 — CID 141469430
2-N-(diaminomethylidene)-1,3-dihydroisoindole-1,2-dicarboximidamide (PubChem CID 141469430) has the molecular formula C11H15N7 and a molecular weight of 245.29 g/mol. Its IUPAC name is 2-N-(diaminomethylidene)-1,3-dihydroisoindole-1,2-dicarboximidamide.
| Compound Name | 2-N-(diaminomethylidene)-1,3-dihydroisoindole-1,2-dicarboximidamide |
|---|---|
| PubChem CID | 141469430 |
| Molecular Formula | C11H15N7 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-N-(diaminomethylidene)-1,3-dihydroisoindole-1,2-dicarboximidamide |
| SMILES | [H]/N=C(\N)C1c2ccccc2CN1/C(N=C(N)N)=N/[H] |
| InChI | InChI=1S/C11H15N7/c12-9(13)8-7-4-2-1-3-6(7)5-18(8)11(16)17-10(14)15/h1-4,8H,5H2,(H3,12,13)(H5,14,15,16,17) |
| InChIKey | BLAPYOLMBRCWHB-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|