C10H12FN5 — CID 103496995
N-(diaminomethylidene)-6-fluoro-2,3-dihydroindole-1-carboximidamide (PubChem CID 103496995) has the molecular formula C10H12FN5 and a molecular weight of 221.24 g/mol. Its IUPAC name is N-(diaminomethylidene)-6-fluoro-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N-(diaminomethylidene)-6-fluoro-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 103496995 |
| Molecular Formula | C10H12FN5 |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-(diaminomethylidene)-6-fluoro-2,3-dihydroindole-1-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C10H12FN5/c11-7-2-1-6-3-4-16(8(6)5-7)10(14)15-9(12)13/h1-2,5H,3-4H2,(H5,12,13,14,15) |
| InChIKey | SVQZJXHCVCPIEB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|