C11H13FN2 — CID 103503764
1-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-imine (PubChem CID 103503764) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is 1-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-imine.
| Compound Name | 1-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-imine |
|---|---|
| PubChem CID | 103503764 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 1-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-imine |
| SMILES | [H]/N=C(\CC)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C11H13FN2/c1-2-11(13)14-6-5-8-3-4-9(12)7-10(8)14/h3-4,7,13H,2,5-6H2,1H3/b13-11+ |
| InChIKey | LPGUNGWZGUHVLL-ACCUITESSA-N |
| XLogP | 2.58 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|