C13H19FN4 — CID 103504865
N-amino-N'-butyl-6-fluoro-2,3-dihydroindole-1-carboximidamide (PubChem CID 103504865) has the molecular formula C13H19FN4 and a molecular weight of 250.32 g/mol. Its IUPAC name is N-amino-N'-butyl-6-fluoro-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N-amino-N'-butyl-6-fluoro-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 103504865 |
| Molecular Formula | C13H19FN4 |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | N-amino-N'-butyl-6-fluoro-2,3-dihydroindole-1-carboximidamide |
| SMILES | CCCC/N=C(\NN)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C13H19FN4/c1-2-3-7-16-13(17-15)18-8-6-10-4-5-11(14)9-12(10)18/h4-5,9H,2-3,6-8,15H2,1H3,(H,16,17) |
| InChIKey | IQMDUAQFWWQIRJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|