C12H14FN3 — CID 103496998
N'-cyclopropyl-6-fluoro-2,3-dihydroindole-1-carboximidamide (PubChem CID 103496998) has the molecular formula C12H14FN3 and a molecular weight of 219.26 g/mol. Its IUPAC name is N'-cyclopropyl-6-fluoro-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N'-cyclopropyl-6-fluoro-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 103496998 |
| Molecular Formula | C12H14FN3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | N'-cyclopropyl-6-fluoro-2,3-dihydroindole-1-carboximidamide |
| SMILES | N/C(=N\C1CC1)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C12H14FN3/c13-9-2-1-8-5-6-16(11(8)7-9)12(14)15-10-3-4-10/h1-2,7,10H,3-6H2,(H2,14,15) |
| InChIKey | DMFMWGWRXBQQMS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|