C28H12FN5OS2 — CID 145413956
10-(6-fluoro-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaen-4-yl)phenoxazine (PubChem CID 145413956) has the molecular formula C28H12FN5OS2 and a molecular weight of 517.57 g/mol. Its IUPAC name is 10-(6-fluoro-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaen-4-yl)phenoxazine.
| Compound Name | 10-(6-fluoro-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaen-4-yl)phenoxazine |
|---|---|
| PubChem CID | 145413956 |
| Molecular Formula | C28H12FN5OS2 |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 10-(6-fluoro-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaen-4-yl)phenoxazine |
| SMILES | Fc1ccc2c3c(ccc(N4c5ccccc5Oc5ccccc54)c13)-c1nc(N=C=S)c(N=C=S)nc1-2 |
| InChI | InChI=1S/C28H12FN5OS2/c29-17-11-9-15-23-16(26-25(15)32-27(30-13-36)28(33-26)31-14-37)10-12-20(24(17)23)34-18-5-1-3-7-21(18)35-22-8-4-2-6-19(22)34/h1-12H |
| InChIKey | MUXSIEWPHSHMMW-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|