C36H20FN5OS2 — CID 145413580
10-[4-(6-fluoro-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaen-4-yl)-2,5-dimethylphenyl]phenoxazine (PubChem CID 145413580) has the molecular formula C36H20FN5OS2 and a molecular weight of 621.72 g/mol. Its IUPAC name is 10-[4-(6-fluoro-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaen-4-yl)-2,5-dimethylphenyl]phenoxazine.
| Compound Name | 10-[4-(6-fluoro-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaen-4-yl)-2,5-dimethylphenyl]phenoxazine |
|---|---|
| PubChem CID | 145413580 |
| Molecular Formula | C36H20FN5OS2 |
| Molecular Weight | 621.72 g/mol |
| Exact Mass | 621.11 |
| IUPAC Name | 10-[4-(6-fluoro-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaen-4-yl)-2,5-dimethylphenyl]phenoxazine |
| SMILES | Cc1cc(N2c3ccccc3Oc3ccccc32)c(C)cc1-c1ccc2c3c(ccc(F)c13)-c1nc(N=C=S)c(N=C=S)nc1-2 |
| InChI | InChI=1S/C36H20FN5OS2/c1-19-16-28(42-26-7-3-5-9-29(26)43-30-10-6-4-8-27(30)42)20(2)15-24(19)21-11-12-22-31-23(13-14-25(37)32(21)31)34-33(22)40-35(38-17-44)36(41-34)39-18-45/h3-16H,1-2H3 |
| InChIKey | WDIYJEDXVYGUCJ-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.72 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|