C41H25N5S2 — CID 145413605
4-[4-(9,9-dimethylacridin-10-yl)naphthalen-1-yl]-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaene (PubChem CID 145413605) has the molecular formula C41H25N5S2 and a molecular weight of 651.82 g/mol. Its IUPAC name is 4-[4-(9,9-dimethylacridin-10-yl)naphthalen-1-yl]-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaene.
| Compound Name | 4-[4-(9,9-dimethylacridin-10-yl)naphthalen-1-yl]-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaene |
|---|---|
| PubChem CID | 145413605 |
| Molecular Formula | C41H25N5S2 |
| Molecular Weight | 651.82 g/mol |
| Exact Mass | 651.16 |
| IUPAC Name | 4-[4-(9,9-dimethylacridin-10-yl)naphthalen-1-yl]-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaene |
| SMILES | CC1(C)c2ccccc2N(c2ccc(-c3ccc4c5c(cccc35)-c3nc(N=C=S)c(N=C=S)nc3-4)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C41H25N5S2/c1-41(2)31-14-5-7-16-34(31)46(35-17-8-6-15-32(35)41)33-21-20-25(24-10-3-4-11-27(24)33)26-18-19-30-36-28(26)12-9-13-29(36)37-38(30)45-40(43-23-48)39(44-37)42-22-47/h3-21H,1-2H3 |
| InChIKey | ZXFNKCCDVGMXQY-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.82 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|