C31H19N5 — CID 145413810
2-(9,9-dimethylacridin-10-yl)-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene-12,13-dicarbonitrile (PubChem CID 145413810) has the molecular formula C31H19N5 and a molecular weight of 461.53 g/mol. Its IUPAC name is 2-(9,9-dimethylacridin-10-yl)-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene-12,13-dicarbonitrile.
| Compound Name | 2-(9,9-dimethylacridin-10-yl)-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene-12,13-dicarbonitrile |
|---|---|
| PubChem CID | 145413810 |
| Molecular Formula | C31H19N5 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 2-(9,9-dimethylacridin-10-yl)-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene-12,13-dicarbonitrile |
| SMILES | CC1(C)c2ccccc2N(c2ccc3cccc4c3c2-c2nc(C#N)c(C#N)nc2-4)c2ccccc21 |
| InChI | InChI=1S/C31H19N5/c1-31(2)20-10-3-5-12-24(20)36(25-13-6-4-11-21(25)31)26-15-14-18-8-7-9-19-27(18)28(26)30-29(19)34-22(16-32)23(17-33)35-30/h3-15H,1-2H3 |
| InChIKey | MEPGMEBOJFDQMH-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 76.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |