C31H19N5S2 — CID 145413787
2-(9,9-dimethylacridin-10-yl)-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaene (PubChem CID 145413787) has the molecular formula C31H19N5S2 and a molecular weight of 525.66 g/mol. Its IUPAC name is 2-(9,9-dimethylacridin-10-yl)-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaene.
| Compound Name | 2-(9,9-dimethylacridin-10-yl)-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaene |
|---|---|
| PubChem CID | 145413787 |
| Molecular Formula | C31H19N5S2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 2-(9,9-dimethylacridin-10-yl)-12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaene |
| SMILES | CC1(C)c2ccccc2N(c2ccc3cccc4c3c2-c2nc(N=C=S)c(N=C=S)nc2-4)c2ccccc21 |
| InChI | InChI=1S/C31H19N5S2/c1-31(2)20-10-3-5-12-22(20)36(23-13-6-4-11-21(23)31)24-15-14-18-8-7-9-19-25(18)26(24)28-27(19)34-29(32-16-37)30(35-28)33-17-38/h3-15H,1-2H3 |
| InChIKey | KYNIITYZDIHGNO-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|