C28H13N5O — CID 145413555
2-phenoxazin-10-yl-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene-12,13-dicarbonitrile (PubChem CID 145413555) has the molecular formula C28H13N5O and a molecular weight of 435.45 g/mol. Its IUPAC name is 2-phenoxazin-10-yl-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene-12,13-dicarbonitrile.
| Compound Name | 2-phenoxazin-10-yl-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene-12,13-dicarbonitrile |
|---|---|
| PubChem CID | 145413555 |
| Molecular Formula | C28H13N5O |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 2-phenoxazin-10-yl-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene-12,13-dicarbonitrile |
| SMILES | N#Cc1nc2c(nc1C#N)-c1c(N3c4ccccc4Oc4ccccc43)ccc3cccc-2c13 |
| InChI | InChI=1S/C28H13N5O/c29-14-18-19(15-30)32-28-26-22(13-12-16-6-5-7-17(25(16)26)27(28)31-18)33-20-8-1-3-10-23(20)34-24-11-4-2-9-21(24)33/h1-13H |
| InChIKey | QECTVGYASQPJBU-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 85.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |