C34H17N5OS2 — CID 145413607
10-[4-(12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaen-4-yl)phenyl]phenoxazine (PubChem CID 145413607) has the molecular formula C34H17N5OS2 and a molecular weight of 575.68 g/mol. Its IUPAC name is 10-[4-(12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaen-4-yl)phenyl]phenoxazine.
| Compound Name | 10-[4-(12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaen-4-yl)phenyl]phenoxazine |
|---|---|
| PubChem CID | 145413607 |
| Molecular Formula | C34H17N5OS2 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.09 |
| IUPAC Name | 10-[4-(12,13-diisothiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10(15),11,13-octaen-4-yl)phenyl]phenoxazine |
| SMILES | S=C=Nc1nc2c(nc1N=C=S)-c1ccc(-c3ccc(N4c5ccccc5Oc5ccccc54)cc3)c3cccc-2c13 |
| InChI | InChI=1S/C34H17N5OS2/c41-18-35-33-34(36-19-42)38-32-25-17-16-22(23-6-5-7-24(30(23)25)31(32)37-33)20-12-14-21(15-13-20)39-26-8-1-3-10-28(26)40-29-11-4-2-9-27(29)39/h1-17H |
| InChIKey | YSVOBXGXPSOZQK-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|