C21H19ClN2O4 — CID 14541510
ethyl (2R)-2-[[2-(5-chloro-1H-indol-3-yl)-2-oxoacetyl]amino]-3-phenylpropanoate (PubChem CID 14541510) has the molecular formula C21H19ClN2O4 and a molecular weight of 398.85 g/mol. Its IUPAC name is ethyl (2R)-2-[[2-(5-chloro-1H-indol-3-yl)-2-oxoacetyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (2R)-2-[[2-(5-chloro-1H-indol-3-yl)-2-oxoacetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 14541510 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | ethyl (2R)-2-[[2-(5-chloro-1H-indol-3-yl)-2-oxoacetyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@H](Cc1ccccc1)NC(=O)C(=O)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C21H19ClN2O4/c1-2-28-21(27)18(10-13-6-4-3-5-7-13)24-20(26)19(25)16-12-23-17-9-8-14(22)11-15(16)17/h3-9,11-12,18,23H,2,10H2,1H3,(H,24,26)/t18-/m1/s1 |
| InChIKey | AMODXXNNQZEAJV-GOSISDBHSA-N |
| XLogP | 3.29 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|