C19H20F4N2O4S — CID 145415296
2-hydroxysulfanyl-3-(trifluoromethyl)pyridine;[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methyl hypofluorite (PubChem CID 145415296) has the molecular formula C19H20F4N2O4S and a molecular weight of 448.44 g/mol. Its IUPAC name is 2-hydroxysulfanyl-3-(trifluoromethyl)pyridine;[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methyl hypofluorite.
| Compound Name | 2-hydroxysulfanyl-3-(trifluoromethyl)pyridine;[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methyl hypofluorite |
|---|---|
| PubChem CID | 145415296 |
| Molecular Formula | C19H20F4N2O4S |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 2-hydroxysulfanyl-3-(trifluoromethyl)pyridine;[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methyl hypofluorite |
| SMILES | O=C(COc1ccc(COF)cc1)N1CCCC1.OSc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C13H16FNO3.C6H4F3NOS/c14-18-9-11-3-5-12(6-4-11)17-10-13(16)15-7-1-2-8-15;7-6(8,9)4-2-1-3-10-5(4)12-11/h3-6H,1-2,7-10H2;1-3,11H |
| InChIKey | DLIHEYDEUOJOLC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|