C20H24F3N3O3S — CID 145415299
acetylene;[1-[2-[4-(hydroxymethyl)phenoxy]acetyl]pyrrolidin-3-yl] (1E)-N-[(Z)-ethylideneamino]-3,3,3-trifluoropropanimidothioate (PubChem CID 145415299) has the molecular formula C20H24F3N3O3S and a molecular weight of 443.49 g/mol. Its IUPAC name is acetylene;[1-[2-[4-(hydroxymethyl)phenoxy]acetyl]pyrrolidin-3-yl] (1E)-N-[(Z)-ethylideneamino]-3,3,3-trifluoropropanimidothioate.
| Compound Name | acetylene;[1-[2-[4-(hydroxymethyl)phenoxy]acetyl]pyrrolidin-3-yl] (1E)-N-[(Z)-ethylideneamino]-3,3,3-trifluoropropanimidothioate |
|---|---|
| PubChem CID | 145415299 |
| Molecular Formula | C20H24F3N3O3S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | acetylene;[1-[2-[4-(hydroxymethyl)phenoxy]acetyl]pyrrolidin-3-yl] (1E)-N-[(Z)-ethylideneamino]-3,3,3-trifluoropropanimidothioate |
| SMILES | C#C.C/C=N\N=C(/CC(F)(F)F)SC1CCN(C(=O)COc2ccc(CO)cc2)C1 |
| InChI | InChI=1S/C18H22F3N3O3S.C2H2/c1-2-22-23-16(9-18(19,20)21)28-15-7-8-24(10-15)17(26)12-27-14-5-3-13(11-25)4-6-14;1-2/h2-6,15,25H,7-12H2,1H3;1-2H/b22-2-,23-16+; |
| InChIKey | XVUVTEUUOQVATQ-NSIUHJCSSA-N |
| XLogP | 3.50 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|