C20H23FN2O4 — CID 145415559
[4-[2-[3-(4-methoxyanilino)pyrrolidin-1-yl]-2-oxoethoxy]phenyl]methyl hypofluorite (PubChem CID 145415559) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is [4-[2-[3-(4-methoxyanilino)pyrrolidin-1-yl]-2-oxoethoxy]phenyl]methyl hypofluorite.
| Compound Name | [4-[2-[3-(4-methoxyanilino)pyrrolidin-1-yl]-2-oxoethoxy]phenyl]methyl hypofluorite |
|---|---|
| PubChem CID | 145415559 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [4-[2-[3-(4-methoxyanilino)pyrrolidin-1-yl]-2-oxoethoxy]phenyl]methyl hypofluorite |
| SMILES | COc1ccc(NC2CCN(C(=O)COc3ccc(COF)cc3)C2)cc1 |
| InChI | InChI=1S/C20H23FN2O4/c1-25-18-8-4-16(5-9-18)22-17-10-11-23(12-17)20(24)14-26-19-6-2-15(3-7-19)13-27-21/h2-9,17,22H,10-14H2,1H3 |
| InChIKey | SPXWHTABXUWPLB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|