C40H47F3N2O5 — CID 145417668
methanol;N-methyl-4-(2,4,6-trimethylphenyl)aniline;N-(3-oxopropyl)-4-[1-oxo-2-[4-(trifluoromethoxy)phenyl]hexan-3-yl]benzamide (PubChem CID 145417668) has the molecular formula C40H47F3N2O5 and a molecular weight of 692.82 g/mol. Its IUPAC name is methanol;N-methyl-4-(2,4,6-trimethylphenyl)aniline;N-(3-oxopropyl)-4-[1-oxo-2-[4-(trifluoromethoxy)phenyl]hexan-3-yl]benzamide.
| Compound Name | methanol;N-methyl-4-(2,4,6-trimethylphenyl)aniline;N-(3-oxopropyl)-4-[1-oxo-2-[4-(trifluoromethoxy)phenyl]hexan-3-yl]benzamide |
|---|---|
| PubChem CID | 145417668 |
| Molecular Formula | C40H47F3N2O5 |
| Molecular Weight | 692.82 g/mol |
| Exact Mass | 692.34 |
| IUPAC Name | methanol;N-methyl-4-(2,4,6-trimethylphenyl)aniline;N-(3-oxopropyl)-4-[1-oxo-2-[4-(trifluoromethoxy)phenyl]hexan-3-yl]benzamide |
| SMILES | CCCC(c1ccc(C(=O)NCCC=O)cc1)C(C=O)c1ccc(OC(F)(F)F)cc1.CNc1ccc(-c2c(C)cc(C)cc2C)cc1.CO |
| InChI | InChI=1S/C23H24F3NO4.C16H19N.CH4O/c1-2-4-20(16-5-7-18(8-6-16)22(30)27-13-3-14-28)21(15-29)17-9-11-19(12-10-17)31-23(24,25)26;1-11-9-12(2)16(13(3)10-11)14-5-7-15(17-4)8-6-14;1-2/h5-12,14-15,20-21H,2-4,13H2,1H3,(H,27,30);5-10,17H,1-4H3;2H,1H3 |
| InChIKey | VRHVPVIZUZCRHQ-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.82 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|