C19H19F2NO2 — CID 145417827
N-[3-(3,5-difluorophenyl)-2-methylpropyl]-2-formyl-N-methylbenzamide (PubChem CID 145417827) has the molecular formula C19H19F2NO2 and a molecular weight of 331.36 g/mol. Its IUPAC name is N-[3-(3,5-difluorophenyl)-2-methylpropyl]-2-formyl-N-methylbenzamide.
| Compound Name | N-[3-(3,5-difluorophenyl)-2-methylpropyl]-2-formyl-N-methylbenzamide |
|---|---|
| PubChem CID | 145417827 |
| Molecular Formula | C19H19F2NO2 |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[3-(3,5-difluorophenyl)-2-methylpropyl]-2-formyl-N-methylbenzamide |
| SMILES | CC(Cc1cc(F)cc(F)c1)CN(C)C(=O)c1ccccc1C=O |
| InChI | InChI=1S/C19H19F2NO2/c1-13(7-14-8-16(20)10-17(21)9-14)11-22(2)19(24)18-6-4-3-5-15(18)12-23/h3-6,8-10,12-13H,7,11H2,1-2H3 |
| InChIKey | RMORTIOPRVONQH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|