C25H37N3O2+2 — CID 165403293
ethyl-[[4-[[2-[(2-formylbenzoyl)-methylamino]ethyl-dimethylazaniumyl]methyl]phenyl]methyl]-dimethylazanium (PubChem CID 165403293) has the molecular formula C25H37N3O2+2 and a molecular weight of 411.59 g/mol. Its IUPAC name is ethyl-[[4-[[2-[(2-formylbenzoyl)-methylamino]ethyl-dimethylazaniumyl]methyl]phenyl]methyl]-dimethylazanium.
| Compound Name | ethyl-[[4-[[2-[(2-formylbenzoyl)-methylamino]ethyl-dimethylazaniumyl]methyl]phenyl]methyl]-dimethylazanium |
|---|---|
| PubChem CID | 165403293 |
| Molecular Formula | C25H37N3O2+2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | ethyl-[[4-[[2-[(2-formylbenzoyl)-methylamino]ethyl-dimethylazaniumyl]methyl]phenyl]methyl]-dimethylazanium |
| SMILES | CC[N+](C)(C)Cc1ccc(C[N+](C)(C)CCN(C)C(=O)c2ccccc2C=O)cc1 |
| InChI | InChI=1S/C25H37N3O2/c1-7-27(3,4)18-21-12-14-22(15-13-21)19-28(5,6)17-16-26(2)25(30)24-11-9-8-10-23(24)20-29/h8-15,20H,7,16-19H2,1-6H3/q+2 |
| InChIKey | PHDDGHPDDSKMPI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|