C16H23NO4P+ — CID 170966342
ethoxy-[5-[(2-formylbenzoyl)-methylamino]pentyl]-oxophosphanium (PubChem CID 170966342) has the molecular formula C16H23NO4P+ and a molecular weight of 324.34 g/mol. Its IUPAC name is ethoxy-[5-[(2-formylbenzoyl)-methylamino]pentyl]-oxophosphanium.
| Compound Name | ethoxy-[5-[(2-formylbenzoyl)-methylamino]pentyl]-oxophosphanium |
|---|---|
| PubChem CID | 170966342 |
| Molecular Formula | C16H23NO4P+ |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | ethoxy-[5-[(2-formylbenzoyl)-methylamino]pentyl]-oxophosphanium |
| SMILES | CCO[P+](=O)CCCCCN(C)C(=O)c1ccccc1C=O |
| InChI | InChI=1S/C16H23NO4P/c1-3-21-22(20)12-8-4-7-11-17(2)16(19)15-10-6-5-9-14(15)13-18/h5-6,9-10,13H,3-4,7-8,11-12H2,1-2H3/q+1 |
| InChIKey | RHHYQOJZNAKANW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|