C19H30ClNO3 — CID 143985176
(Z)-but-2-ene;N-(3-chloro-2-hydroxypropyl)-2-formyl-N-methylbenzamide;propane (PubChem CID 143985176) has the molecular formula C19H30ClNO3 and a molecular weight of 355.91 g/mol. Its IUPAC name is (Z)-but-2-ene;N-(3-chloro-2-hydroxypropyl)-2-formyl-N-methylbenzamide;propane.
| Compound Name | (Z)-but-2-ene;N-(3-chloro-2-hydroxypropyl)-2-formyl-N-methylbenzamide;propane |
|---|---|
| PubChem CID | 143985176 |
| Molecular Formula | C19H30ClNO3 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (Z)-but-2-ene;N-(3-chloro-2-hydroxypropyl)-2-formyl-N-methylbenzamide;propane |
| SMILES | C/C=C\C.CCC.CN(CC(O)CCl)C(=O)c1ccccc1C=O |
| InChI | InChI=1S/C12H14ClNO3.C4H8.C3H8/c1-14(7-10(16)6-13)12(17)11-5-3-2-4-9(11)8-15;1-3-4-2;1-3-2/h2-5,8,10,16H,6-7H2,1H3;3-4H,1-2H3;3H2,1-2H3/b;4-3-; |
| InChIKey | KYOBBJSQONDKBK-LWFKIUJUSA-N |
| XLogP | 4.17 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|