C20H16BrF2N3O2S — CID 145417839
3-bromo-N-[1-[(3,5-difluorophenyl)methyl]cyclopropyl]-9-oxa-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide (PubChem CID 145417839) has the molecular formula C20H16BrF2N3O2S and a molecular weight of 480.33 g/mol. Its IUPAC name is 3-bromo-N-[1-[(3,5-difluorophenyl)methyl]cyclopropyl]-9-oxa-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide.
| Compound Name | 3-bromo-N-[1-[(3,5-difluorophenyl)methyl]cyclopropyl]-9-oxa-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 145417839 |
| Molecular Formula | C20H16BrF2N3O2S |
| Molecular Weight | 480.33 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | 3-bromo-N-[1-[(3,5-difluorophenyl)methyl]cyclopropyl]-9-oxa-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide |
| SMILES | O=C(NC1(Cc2cc(F)cc(F)c2)CC1)c1cc2c(s1)OCCn1ncc(Br)c1-2 |
| InChI | InChI=1S/C20H16BrF2N3O2S/c21-15-10-24-26-3-4-28-19-14(17(15)26)8-16(29-19)18(27)25-20(1-2-20)9-11-5-12(22)7-13(23)6-11/h5-8,10H,1-4,9H2,(H,25,27) |
| InChIKey | XTKSTBREGJQHOP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |