C28H26F4N6O — CID 145419894
1-[3-[3-[2-fluoro-4-[(2,3,6-trifluoro-5-methylphenyl)methyl]phenyl]-4-(methylamino)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 145419894) has the molecular formula C28H26F4N6O and a molecular weight of 538.55 g/mol. Its IUPAC name is 1-[3-[3-[2-fluoro-4-[(2,3,6-trifluoro-5-methylphenyl)methyl]phenyl]-4-(methylamino)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[3-[2-fluoro-4-[(2,3,6-trifluoro-5-methylphenyl)methyl]phenyl]-4-(methylamino)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 145419894 |
| Molecular Formula | C28H26F4N6O |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 1-[3-[3-[2-fluoro-4-[(2,3,6-trifluoro-5-methylphenyl)methyl]phenyl]-4-(methylamino)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(n2nc(-c3ccc(Cc4c(F)c(C)cc(F)c4F)cc3F)c3c(NC)ncnc32)C1 |
| InChI | InChI=1S/C28H26F4N6O/c1-4-22(39)37-9-5-6-17(13-37)38-28-23(27(33-3)34-14-35-28)26(36-38)18-8-7-16(12-20(18)29)11-19-24(31)15(2)10-21(30)25(19)32/h4,7-8,10,12,14,17H,1,5-6,9,11,13H2,2-3H3,(H,33,34,35) |
| InChIKey | CFNCEIUDPJBGAK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|