C23H32N6O3 — CID 145420765
4-amino-2-butoxy-8-[[3-[[(3R)-3-methoxypyrrolidin-1-yl]methyl]phenyl]methyl]-5,7-dihydropteridin-6-one (PubChem CID 145420765) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is 4-amino-2-butoxy-8-[[3-[[(3R)-3-methoxypyrrolidin-1-yl]methyl]phenyl]methyl]-5,7-dihydropteridin-6-one.
| Compound Name | 4-amino-2-butoxy-8-[[3-[[(3R)-3-methoxypyrrolidin-1-yl]methyl]phenyl]methyl]-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 145420765 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 4-amino-2-butoxy-8-[[3-[[(3R)-3-methoxypyrrolidin-1-yl]methyl]phenyl]methyl]-5,7-dihydropteridin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N(Cc1cccc(CN3CC[C@@H](OC)C3)c1)CC(=O)N2 |
| InChI | InChI=1S/C23H32N6O3/c1-3-4-10-32-23-26-21(24)20-22(27-23)29(15-19(30)25-20)13-17-7-5-6-16(11-17)12-28-9-8-18(14-28)31-2/h5-7,11,18H,3-4,8-10,12-15H2,1-2H3,(H,25,30)(H2,24,26,27)/t18-/m1/s1 |
| InChIKey | DJPWBJVDHYKEND-GOSISDBHSA-N |
| XLogP | 2.42 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|