C19H25F3O3 — CID 145421674
6-[4-[difluoro-(3-fluoro-4-methylphenoxy)methyl]cyclohexyl]oxan-3-ol (PubChem CID 145421674) has the molecular formula C19H25F3O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 6-[4-[difluoro-(3-fluoro-4-methylphenoxy)methyl]cyclohexyl]oxan-3-ol.
| Compound Name | 6-[4-[difluoro-(3-fluoro-4-methylphenoxy)methyl]cyclohexyl]oxan-3-ol |
|---|---|
| PubChem CID | 145421674 |
| Molecular Formula | C19H25F3O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 6-[4-[difluoro-(3-fluoro-4-methylphenoxy)methyl]cyclohexyl]oxan-3-ol |
| SMILES | Cc1ccc(OC(F)(F)C2CCC(C3CCC(O)CO3)CC2)cc1F |
| InChI | InChI=1S/C19H25F3O3/c1-12-2-8-16(10-17(12)20)25-19(21,22)14-5-3-13(4-6-14)18-9-7-15(23)11-24-18/h2,8,10,13-15,18,23H,3-7,9,11H2,1H3 |
| InChIKey | RIIHBCVBOUOECF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |