C15H20O2 — CID 145422856
[cyclohex-3-en-1-ylmethoxy(methoxy)methyl]benzene (PubChem CID 145422856) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is [cyclohex-3-en-1-ylmethoxy(methoxy)methyl]benzene.
| Compound Name | [cyclohex-3-en-1-ylmethoxy(methoxy)methyl]benzene |
|---|---|
| PubChem CID | 145422856 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | [cyclohex-3-en-1-ylmethoxy(methoxy)methyl]benzene |
| SMILES | COC(OCC1CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C15H20O2/c1-16-15(14-10-6-3-7-11-14)17-12-13-8-4-2-5-9-13/h2-4,6-7,10-11,13,15H,5,8-9,12H2,1H3 |
| InChIKey | BLRGTIFVLVPLCJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|