C12H13N3S — CID 145425226
4,5,10,12-tetramethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaene (PubChem CID 145425226) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 4,5,10,12-tetramethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaene.
| Compound Name | 4,5,10,12-tetramethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaene |
|---|---|
| PubChem CID | 145425226 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 4,5,10,12-tetramethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaene |
| SMILES | Cc1cc(C)c2c(n1)sc1c(C)n(C)nc12 |
| InChI | InChI=1S/C12H13N3S/c1-6-5-7(2)13-12-9(6)10-11(16-12)8(3)15(4)14-10/h5H,1-4H3 |
| InChIKey | UOURYOGAUVROLE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |