C19H29N3O — CID 145429033
N-(2,2-dimethylpent-4-enyl)-N-methyl-2-piperazin-1-ylbenzamide (PubChem CID 145429033) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is N-(2,2-dimethylpent-4-enyl)-N-methyl-2-piperazin-1-ylbenzamide.
| Compound Name | N-(2,2-dimethylpent-4-enyl)-N-methyl-2-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 145429033 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | N-(2,2-dimethylpent-4-enyl)-N-methyl-2-piperazin-1-ylbenzamide |
| SMILES | C=CCC(C)(C)CN(C)C(=O)c1ccccc1N1CCNCC1 |
| InChI | InChI=1S/C19H29N3O/c1-5-10-19(2,3)15-21(4)18(23)16-8-6-7-9-17(16)22-13-11-20-12-14-22/h5-9,20H,1,10-15H2,2-4H3 |
| InChIKey | QWAGVMKDPIXPHV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|