C10H12F3NO — CID 145433323
N-[2-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]ethyl]formamide (PubChem CID 145433323) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is N-[2-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]ethyl]formamide.
| Compound Name | N-[2-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]ethyl]formamide |
|---|---|
| PubChem CID | 145433323 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N-[2-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]ethyl]formamide |
| SMILES | O=CNCCC1=CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H12F3NO/c11-10(12,13)9-3-1-8(2-4-9)5-6-14-7-15/h1,3,7H,2,4-6H2,(H,14,15) |
| InChIKey | MWLQOJYBUMQZPY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|