C13H16F3NO — CID 123980269
N-[3-[3-methyl-5-(trifluoromethyl)cyclohepta-1,5,6-trien-1-yl]propyl]formamide (PubChem CID 123980269) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is N-[3-[3-methyl-5-(trifluoromethyl)cyclohepta-1,5,6-trien-1-yl]propyl]formamide.
| Compound Name | N-[3-[3-methyl-5-(trifluoromethyl)cyclohepta-1,5,6-trien-1-yl]propyl]formamide |
|---|---|
| PubChem CID | 123980269 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-[3-[3-methyl-5-(trifluoromethyl)cyclohepta-1,5,6-trien-1-yl]propyl]formamide |
| SMILES | CC1C=C(CCCNC=O)C=C=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H16F3NO/c1-10-7-11(3-2-6-17-9-18)4-5-12(8-10)13(14,15)16/h4,7,9-10H,2-3,6,8H2,1H3,(H,17,18) |
| InChIKey | JFYQIHOCMBCKNY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|