C15H23NO — CID 143367135
N-[(5E,7Z,9E)-4,10-dimethyldodeca-5,7,9,11-tetraenyl]formamide (PubChem CID 143367135) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is N-[(5E,7Z,9E)-4,10-dimethyldodeca-5,7,9,11-tetraenyl]formamide.
| Compound Name | N-[(5E,7Z,9E)-4,10-dimethyldodeca-5,7,9,11-tetraenyl]formamide |
|---|---|
| PubChem CID | 143367135 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-[(5E,7Z,9E)-4,10-dimethyldodeca-5,7,9,11-tetraenyl]formamide |
| SMILES | C=C/C(C)=C/C=C\C=C\C(C)CCCNC=O |
| InChI | InChI=1S/C15H23NO/c1-4-14(2)9-6-5-7-10-15(3)11-8-12-16-13-17/h4-7,9-10,13,15H,1,8,11-12H2,2-3H3,(H,16,17)/b6-5-,10-7+,14-9+ |
| InChIKey | ULMBCEIZNBYLGV-XFDZZESJSA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|