C11H21NO — CID 86076600
N-(3,7-dimethyloct-6-enyl)formamide (PubChem CID 86076600) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is N-(3,7-dimethyloct-6-enyl)formamide.
| Compound Name | N-(3,7-dimethyloct-6-enyl)formamide |
|---|---|
| PubChem CID | 86076600 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | N-(3,7-dimethyloct-6-enyl)formamide |
| SMILES | CC(C)=CCCC(C)CCNC=O |
| InChI | InChI=1S/C11H21NO/c1-10(2)5-4-6-11(3)7-8-12-9-13/h5,9,11H,4,6-8H2,1-3H3,(H,12,13) |
| InChIKey | JMPJBHCHCZNGSH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|