C11H19NO — CID 164666523
N-[2-[(1S)-4-methylcyclohex-3-en-1-yl]propan-2-yl]formamide (PubChem CID 164666523) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is N-[2-[(1S)-4-methylcyclohex-3-en-1-yl]propan-2-yl]formamide.
| Compound Name | N-[2-[(1S)-4-methylcyclohex-3-en-1-yl]propan-2-yl]formamide |
|---|---|
| PubChem CID | 164666523 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-[2-[(1S)-4-methylcyclohex-3-en-1-yl]propan-2-yl]formamide |
| SMILES | CC1=CC[C@@H](C(C)(C)NC=O)CC1 |
| InChI | InChI=1S/C11H19NO/c1-9-4-6-10(7-5-9)11(2,3)12-8-13/h4,8,10H,5-7H2,1-3H3,(H,12,13)/t10-/m1/s1 |
| InChIKey | VDVYQWXHTAPRGD-SNVBAGLBSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|