C13H21NO — CID 142586757
N-[2-(3,4-dimethylcyclohepta-1,3-dien-1-yl)propyl]formamide (PubChem CID 142586757) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is N-[2-(3,4-dimethylcyclohepta-1,3-dien-1-yl)propyl]formamide.
| Compound Name | N-[2-(3,4-dimethylcyclohepta-1,3-dien-1-yl)propyl]formamide |
|---|---|
| PubChem CID | 142586757 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-[2-(3,4-dimethylcyclohepta-1,3-dien-1-yl)propyl]formamide |
| SMILES | CC1=C(C)CCCC(C(C)CNC=O)=C1 |
| InChI | InChI=1S/C13H21NO/c1-10-5-4-6-13(7-11(10)2)12(3)8-14-9-15/h7,9,12H,4-6,8H2,1-3H3,(H,14,15) |
| InChIKey | KKIQCIMVYIOQJF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|