C17H29NO — CID 59545833
N-[(3E,5Z)-5-[2-(4-methylcyclohexyl)ethyl]hepta-3,5-dienyl]formamide (PubChem CID 59545833) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is N-[(3E,5Z)-5-[2-(4-methylcyclohexyl)ethyl]hepta-3,5-dienyl]formamide.
| Compound Name | N-[(3E,5Z)-5-[2-(4-methylcyclohexyl)ethyl]hepta-3,5-dienyl]formamide |
|---|---|
| PubChem CID | 59545833 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | N-[(3E,5Z)-5-[2-(4-methylcyclohexyl)ethyl]hepta-3,5-dienyl]formamide |
| SMILES | C/C=C(\C=C\CCNC=O)CCC1CCC(C)CC1 |
| InChI | InChI=1S/C17H29NO/c1-3-16(6-4-5-13-18-14-19)11-12-17-9-7-15(2)8-10-17/h3-4,6,14-15,17H,5,7-13H2,1-2H3,(H,18,19)/b6-4+,16-3+ |
| InChIKey | CYOSRPRVMZRYLT-KUAJAKGOSA-N |
| XLogP | 4.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|