C16H27NO — CID 91215157
N-[(3E,5Z)-5-(2-cyclohexylethyl)hepta-3,5-dienyl]formamide (PubChem CID 91215157) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is N-[(3E,5Z)-5-(2-cyclohexylethyl)hepta-3,5-dienyl]formamide.
| Compound Name | N-[(3E,5Z)-5-(2-cyclohexylethyl)hepta-3,5-dienyl]formamide |
|---|---|
| PubChem CID | 91215157 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-[(3E,5Z)-5-(2-cyclohexylethyl)hepta-3,5-dienyl]formamide |
| SMILES | C/C=C(\C=C\CCNC=O)CCC1CCCCC1 |
| InChI | InChI=1S/C16H27NO/c1-2-15(8-6-7-13-17-14-18)11-12-16-9-4-3-5-10-16/h2,6,8,14,16H,3-5,7,9-13H2,1H3,(H,17,18)/b8-6+,15-2+ |
| InChIKey | GCSFHPGWKNXXGI-FPLPLHDLSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|