C14H23NO — CID 91005878
N-(6,8-dimethylundeca-6,8,10-trien-2-yl)formamide (PubChem CID 91005878) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is N-(6,8-dimethylundeca-6,8,10-trien-2-yl)formamide.
| Compound Name | N-(6,8-dimethylundeca-6,8,10-trien-2-yl)formamide |
|---|---|
| PubChem CID | 91005878 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-(6,8-dimethylundeca-6,8,10-trien-2-yl)formamide |
| SMILES | C=CC=C(C)C=C(C)CCCC(C)NC=O |
| InChI | InChI=1S/C14H23NO/c1-5-7-12(2)10-13(3)8-6-9-14(4)15-11-16/h5,7,10-11,14H,1,6,8-9H2,2-4H3,(H,15,16) |
| InChIKey | KCLBWERVILBEFD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|