C11H18FNO — CID 142122835
N-[(4E,7E)-8-fluoro-4-methylnona-4,7-dien-2-yl]formamide (PubChem CID 142122835) has the molecular formula C11H18FNO and a molecular weight of 199.27 g/mol. Its IUPAC name is N-[(4E,7E)-8-fluoro-4-methylnona-4,7-dien-2-yl]formamide.
| Compound Name | N-[(4E,7E)-8-fluoro-4-methylnona-4,7-dien-2-yl]formamide |
|---|---|
| PubChem CID | 142122835 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N-[(4E,7E)-8-fluoro-4-methylnona-4,7-dien-2-yl]formamide |
| SMILES | C/C(F)=C\C/C=C(\C)CC(C)NC=O |
| InChI | InChI=1S/C11H18FNO/c1-9(5-4-6-10(2)12)7-11(3)13-8-14/h5-6,8,11H,4,7H2,1-3H3,(H,13,14)/b9-5+,10-6+ |
| InChIKey | LJZHCXQYOCMVSI-NXZHAISVSA-N |
| XLogP | 2.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|