C29H36ClN3O4S2 — CID 145433837
2-[4-[(3-chloro-2-methylphenyl)sulfanyl-[2-[3-(3-ethyl-4-pyridinyl)phenyl]propan-2-yl]amino]butanoylamino]ethanesulfonic acid (PubChem CID 145433837) has the molecular formula C29H36ClN3O4S2 and a molecular weight of 590.21 g/mol. Its IUPAC name is 2-[4-[(3-chloro-2-methylphenyl)sulfanyl-[2-[3-(3-ethyl-4-pyridinyl)phenyl]propan-2-yl]amino]butanoylamino]ethanesulfonic acid.
| Compound Name | 2-[4-[(3-chloro-2-methylphenyl)sulfanyl-[2-[3-(3-ethyl-4-pyridinyl)phenyl]propan-2-yl]amino]butanoylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 145433837 |
| Molecular Formula | C29H36ClN3O4S2 |
| Molecular Weight | 590.21 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | 2-[4-[(3-chloro-2-methylphenyl)sulfanyl-[2-[3-(3-ethyl-4-pyridinyl)phenyl]propan-2-yl]amino]butanoylamino]ethanesulfonic acid |
| SMILES | CCc1cnccc1-c1cccc(C(C)(C)N(CCCC(=O)NCCS(=O)(=O)O)Sc2cccc(Cl)c2C)c1 |
| InChI | InChI=1S/C29H36ClN3O4S2/c1-5-22-20-31-15-14-25(22)23-9-6-10-24(19-23)29(3,4)33(38-27-12-7-11-26(30)21(27)2)17-8-13-28(34)32-16-18-39(35,36)37/h6-7,9-12,14-15,19-20H,5,8,13,16-18H2,1-4H3,(H,32,34)(H,35,36,37) |
| InChIKey | UIDODSUVMJTJLI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.21 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|