C32H41ClN4O4S2 — CID 145434020
2-[2-[2-[5-[(3-chloro-2-methylphenyl)sulfanyl-[1-[3-(3-methyl-4-pyridinyl)phenyl]ethyl]amino]pentanoylamino]ethoxy]ethylamino]sulfanylacetic acid (PubChem CID 145434020) has the molecular formula C32H41ClN4O4S2 and a molecular weight of 645.29 g/mol. Its IUPAC name is 2-[2-[2-[5-[(3-chloro-2-methylphenyl)sulfanyl-[1-[3-(3-methyl-4-pyridinyl)phenyl]ethyl]amino]pentanoylamino]ethoxy]ethylamino]sulfanylacetic acid.
| Compound Name | 2-[2-[2-[5-[(3-chloro-2-methylphenyl)sulfanyl-[1-[3-(3-methyl-4-pyridinyl)phenyl]ethyl]amino]pentanoylamino]ethoxy]ethylamino]sulfanylacetic acid |
|---|---|
| PubChem CID | 145434020 |
| Molecular Formula | C32H41ClN4O4S2 |
| Molecular Weight | 645.29 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | 2-[2-[2-[5-[(3-chloro-2-methylphenyl)sulfanyl-[1-[3-(3-methyl-4-pyridinyl)phenyl]ethyl]amino]pentanoylamino]ethoxy]ethylamino]sulfanylacetic acid |
| SMILES | Cc1cnccc1-c1cccc(C(C)N(CCCCC(=O)NCCOCCNSCC(=O)O)Sc2cccc(Cl)c2C)c1 |
| InChI | InChI=1S/C32H41ClN4O4S2/c1-23-21-34-14-13-28(23)27-9-6-8-26(20-27)25(3)37(43-30-11-7-10-29(33)24(30)2)17-5-4-12-31(38)35-15-18-41-19-16-36-42-22-32(39)40/h6-11,13-14,20-21,25,36H,4-5,12,15-19,22H2,1-3H3,(H,35,38)(H,39,40) |
| InChIKey | CVAMBNLYCVGWGN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.29 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|