C29H31ClN4O7S2 — CID 155143968
[[2-[3-[(3-chloro-2-methylphenyl)sulfonyl-[1-[3-(3-methyl-4-pyridinyl)phenyl]ethyl]amino]propylamino]-3,4-dioxocyclobuten-1-yl]amino]methanesulfonic acid (PubChem CID 155143968) has the molecular formula C29H31ClN4O7S2 and a molecular weight of 647.18 g/mol. Its IUPAC name is [[2-[3-[(3-chloro-2-methylphenyl)sulfonyl-[1-[3-(3-methyl-4-pyridinyl)phenyl]ethyl]amino]propylamino]-3,4-dioxocyclobuten-1-yl]amino]methanesulfonic acid.
| Compound Name | [[2-[3-[(3-chloro-2-methylphenyl)sulfonyl-[1-[3-(3-methyl-4-pyridinyl)phenyl]ethyl]amino]propylamino]-3,4-dioxocyclobuten-1-yl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 155143968 |
| Molecular Formula | C29H31ClN4O7S2 |
| Molecular Weight | 647.18 g/mol |
| Exact Mass | 646.13 |
| IUPAC Name | [[2-[3-[(3-chloro-2-methylphenyl)sulfonyl-[1-[3-(3-methyl-4-pyridinyl)phenyl]ethyl]amino]propylamino]-3,4-dioxocyclobuten-1-yl]amino]methanesulfonic acid |
| SMILES | Cc1cnccc1-c1cccc(C(C)N(CCCNc2c(NCS(=O)(=O)O)c(=O)c2=O)S(=O)(=O)c2cccc(Cl)c2C)c1 |
| InChI | InChI=1S/C29H31ClN4O7S2/c1-18-16-31-13-11-23(18)22-8-4-7-21(15-22)20(3)34(43(40,41)25-10-5-9-24(30)19(25)2)14-6-12-32-26-27(29(36)28(26)35)33-17-42(37,38)39/h4-5,7-11,13,15-16,20,32-33H,6,12,14,17H2,1-3H3,(H,37,38,39) |
| InChIKey | WDSODNFGJPMPKT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.18 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|