C29H41F2N3O4 — CID 145434374
tert-butyl (3R)-3-ethylpyrrolidine-1-carboxylate;bis(N-[2-(4-fluorophenyl)ethyl]formamide) (PubChem CID 145434374) has the molecular formula C29H41F2N3O4 and a molecular weight of 533.66 g/mol. Its IUPAC name is tert-butyl (3R)-3-ethylpyrrolidine-1-carboxylate;bis(N-[2-(4-fluorophenyl)ethyl]formamide).
| Compound Name | tert-butyl (3R)-3-ethylpyrrolidine-1-carboxylate;bis(N-[2-(4-fluorophenyl)ethyl]formamide) |
|---|---|
| PubChem CID | 145434374 |
| Molecular Formula | C29H41F2N3O4 |
| Molecular Weight | 533.66 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | tert-butyl (3R)-3-ethylpyrrolidine-1-carboxylate;bis(N-[2-(4-fluorophenyl)ethyl]formamide) |
| SMILES | CC[C@@H]1CCN(C(=O)OC(C)(C)C)C1.O=CNCCc1ccc(F)cc1.O=CNCCc1ccc(F)cc1 |
| InChI | InChI=1S/C11H21NO2.2C9H10FNO/c1-5-9-6-7-12(8-9)10(13)14-11(2,3)4;2*10-9-3-1-8(2-4-9)5-6-11-7-12/h9H,5-8H2,1-4H3;2*1-4,7H,5-6H2,(H,11,12)/t9-;;/m1../s1 |
| InChIKey | VSMXFLAPQCXIFF-KLQYNRQASA-N |
| XLogP | 4.88 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|